In-silico ADMET risk and developability triage for CNS-oriented human small-molecule lead candidates.
| Molecule ID | Amiodarone |
| Input SMILES | CCCCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)I)OCCN(CC)CC)I |
| Standardized SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 |
| herg safety score | 0.06 |
| cyp ddi score | 0.45 |
| bbb score | 0.69 |
| pgp score | 0.52 |
| blood/brain ratio | 1.13 |
| efflux ratio | 2.30 |
| vdss score | 0.4 |
| ppb score | 0.14 |
| half life score | 0.5 |
| vdss l/kg | 12.7 |
| ppb percent | 99.64 |
| half life hour | 12.9 |
| solubility score | 0.23 |
| logd74 score | 0.24 |
| solubility logs | -6.07 |
| logd74 value | 4.91 |
| Prediction source | Leak-safe prediction (exact isomeric match, reduced quality) |
| Predicted IC50 | 0.241 µM (pIC50: 6.62) |
| 10× reliability | 74% (≈0.0241–2.41 µM) |
| 3× precision | 45% (≈0.0802–0.722 µM) |
| Label | Likely high hERG risk |
| hERG safety score | 0.06 (model max: 0.88) |
| Prediction source | Full model prediction |
| Predicted IC50 | 2.67 µM (pIC50: 5.57) |
| 10× reliability | 87% (≈0.267–26.7 µM) |
| 3× precision | 55% (≈0.89–8.01 µM) |
| Label | Likely moderate inhibitor |
| CYP3A4 safety score | 0.41 (model max: 0.77) |
| Prediction source | Full model prediction |
| Predicted IC50 | 6.14 µM (pIC50: 5.21) |
| 10× reliability | 89% (≈0.614–61.4 µM) |
| 3× precision | 58% (≈2.05–18.4 µM) |
| Label | Likely moderate inhibitor |
| CYP2D6 safety score | 0.52 (model max: 0.88) |
| Prediction source | Full model prediction |
| Predicted IC50 | 2.14 µM (pIC50: 5.67) |
| 10× reliability | 91% (≈0.214–21.4 µM) |
| 3× precision | 53% (≈0.713–6.41 µM) |
| Label | Likely strong to moderate inhibitor |
| CYP2C9 safety score | 0.42 (model max: 0.63) |
| Prediction source | Leak-safe prediction (exact isomeric match, reduced quality) |
| Target range (LogBB) | 0.00 to 0.50 |
| Predicted logBB | 0.0534 |
| Brain/Blood ratio | 1.1308 |
| LogBB label | Good (likely within target range) |
| LogBB score | 0.69 (model max: 0.75) |
| Prediction source | Full model prediction |
| Predicted log10(ER) | 0.3626 |
| Predicted efflux ratio | 2.305 |
| P-gp substrate label | Borderline substrate |
| P-gp substrate score | 0.52 (model max: 0.95) |
| Prediction source | Full model prediction |
| Target range (LogS) | -4.00 to -2.50 |
| Predicted solubility (LogS) | -6.0662 |
| Solubility label | Low solubility (below target) |
| Solubility score | 0.23 (model max: 0.81) |
| Prediction source | Full model prediction |
| Calibrated target | 84-98% binding rate |
| Predicted log10(fu) | -2.4431 |
| Predicted fu fraction | 0.0036 |
| Predicted PPB (%) | 99.6395 |
| PPB label | Likely too high |
| PPB score | 0.14 (model max: 0.76) |
| Prediction source | Full model prediction |
| Calibrated target range | 0.58-6.4 L/kg |
| Predicted log10(Vdss L/kg) | 1.1046 |
| Predicted Vdss (L/kg) | 12.7221 |
| Vdss label | Uncertain (mid to very high, requires secondary signals) |
| Vdss score | 0.40 (model max: 0.66) |
| Prediction source | Full model prediction |
| Target range | 3-24 hours |
| Predicted log10(half-life hr) | 1.1119 |
| Predicted half-life (hr) | 12.9376 |
| Half-life label | Good (likely within target range) |
| Half-life score | 0.50 (model max: 0.50) |
| Prediction source | Leak-safe prediction (exact isomeric match, reduced quality) |
| Calibrated target | 1.90-3.55 |
| Predicted logD7.4 | 4.9128 |
| logD7.4 label | Likely extremely high |
| logD7.4 score | 0.24 (model max: 0.81) |